Drugs present in MMsINC which are similar to the molecule MMscode: MMs03217109
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725834 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.74 |
MMs01725836 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.74 |
MMs01726763 | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.73 |
MMs01726765 | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.73 |
MMs01726759 | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.73 |
MMs01726761 | P(OCC1OC(n2c3nc(F)nc(N)c3nc2)C(O)C1O)(O)(O)=O | 0.73 |
MMs01727507 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(OP(OP(O)(O)=O)(O)=O)(O)=O | 0.72 |
MMs01727505 | P(OCC1OC(n2c3ncnc(N)c3nc2)C(O)C1O)(OP(OP(O)(O)=O)(O)=O)(O)=O | 0.72 |
MMs01725809 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.70 |
MMs01725833 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.70 |