Drugs present in MMsINC which are similar to the molecule MMscode: MMs03213393
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725077 | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.76 |
MMs01725448 | Oc1cc(ccc1O)CC(N)C(O)=O | 0.75 |
MMs01725108 | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.72 |
MMs01724882 | Oc1cc([N+](CC)(C)C)ccc1 | 0.71 |
MMs01725376 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.71 |