Drugs present in MMsINC which are similar to the molecule MMscode: MMs03213191
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724965 | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.76 |
MMs01725077 | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.76 |
MMs01725668 | Oc1ccc(cc1)CC(N)C | 0.76 |
MMs01725662 | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01724903 | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01725023 | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01725664 | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01725448 | Oc1cc(ccc1O)CC(N)C(O)=O | 0.75 |
MMs01725108 | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.72 |
MMs01724882 | Oc1cc([N+](CC)(C)C)ccc1 | 0.71 |
MMs01725376 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.71 |
MMs01726603 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.71 |
MMs01726605 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.71 |
MMs01726607 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.71 |
MMs01726068 | Oc1c(O)c(O)ccc1CNNC(=O)C(N)CO | 0.70 |
MMs01726069 | Oc1c(O)c(O)ccc1CNNC(=O)C(N)CO | 0.70 |