Drugs present in MMsINC which are similar to the molecule MMscode: MMs03212306
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724795 | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.82 |
MMs01726520 | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.81 |
MMs01724867 | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.81 |
MMs01726137 | OC12C3(CCCC1)CCN(C2Cc1c3cc(O)cc1)CC1CCC1 | 0.79 |
MMs01725838 | O(C)c1cc2C34C(C(N(CC3)C)Cc2cc1)CCCC4 | 0.76 |
MMs01725376 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.71 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.71 |