Drugs present in MMsINC which are similar to the molecule MMscode: MMs03210923
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726669 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.74 |
MMs01726673 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.74 |
MMs01726671 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.74 |
MMs01725949 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.74 |
MMs01725017 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.74 |
MMs01725331 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.74 |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.72 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.72 |
MMs01725308 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.71 |
MMs01725018 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.71 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.71 |
MMs01727455 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727449 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727451 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727453 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727289 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727291 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727293 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727295 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.70 |