Drugs present in MMsINC which are similar to the molecule MMscode: MMs03207784
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726163 | O=C1CCC(C)(C)C(\C=C\C(=C\C=C\C(=C\C=C\C=C(\C=C/C=C(/C=C\C2=C(C)C(=O)CCC2(C)C)\C)/C)\C)\C)=C1C | 0.84 |
MMs01726737 | O=C1CCC2C3C(CCC12C)C1(C(=CC(=O)C=C1)C(C3)=C)C | 0.74 |
MMs01726738 | O=C1CCC2C3C(CCC12C)C1(C(=CC(=O)C=C1)C(C3)=C)C | 0.74 |
MMs01726739 | O=C1CCC2C3C(CCC12C)C1(C(=CC(=O)C=C1)C(C3)=C)C | 0.74 |
MMs01726740 | O=C1CCC2C3C(CCC12C)C1(C(=CC(=O)C=C1)C(C3)=C)C | 0.74 |