Drugs present in MMsINC which are similar to the molecule MMscode: MMs03203163
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727039 | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.74 |
MMs01727040 | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.74 |
MMs01727041 | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.74 |
MMs01726502 | OC1(CCC2C3C(C4(C(=CC(=O)CC4)CC3)C)C(=O)CC12C)C(=O)CO | 0.72 |
MMs01726505 | OC1(CCC2C3C(C4(C(=CC(=O)CC4)CC3)C)C(=O)CC12C)C(=O)CO | 0.72 |
MMs01726503 | OC1(CCC2C3C(C4(C(=CC(=O)CC4)CC3)C)C(=O)CC12C)C(=O)CO | 0.72 |
MMs01726504 | OC1(CCC2C3C(C4(C(=CC(=O)CC4)CC3)C)C(=O)CC12C)C(=O)CO | 0.72 |