Drugs present in MMsINC which are similar to the molecule MMscode: MMs03183937
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724766 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.75 |
MMs01725842 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.73 |
MMs01725844 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.73 |
MMs01725846 | s1cccc1CC(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.73 |
MMs01725408 | S1C(Cc2ccc(OCCN(C)c3ncccc3)cc2)C(=O)NC1=O | 0.70 |