Drugs present in MMsINC which are similar to the molecule MMscode: MMs03183348
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725161![]() | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.73 |
MMs01725769![]() | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725524![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.72 |
MMs01725525![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.72 |