Drugs present in MMsINC which are similar to the molecule MMscode: MMs03168180
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726673![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.75 |
MMs01726671![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.75 |
MMs01725949![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.75 |
MMs01726669![]() | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.75 |
MMs01725325![]() | O1CCNC(C)C1c1ccccc1 | 0.74 |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.74 |
MMs01725323![]() | O1CCNC(C)C1c1ccccc1 | 0.74 |
MMs01725327![]() | O1CCNC(C)C1c1ccccc1 | 0.74 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01725309![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01725292![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01727455![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727451![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727453![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727289![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727291![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727293![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727295![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01727449![]() | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.70 |
MMs01724794![]() | O1C(c2ccccc2)C(=O)N=C1N | 0.70 |
MMs01725371![]() | O1C(c2ccccc2)C(=O)N=C1N | 0.70 |