Drugs present in MMsINC which are similar to the molecule MMscode: MMs03167853
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.72 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.72 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.72 |
MMs01727449 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01727451 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01727453 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01727455 | O(C(=O)C(NC(C(=O)N1C2C(CC1C(O)=O)CCCC2)C)CCc1ccccc1)CC | 0.72 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |