Drugs present in MMsINC which are similar to the molecule MMscode: MMs03130809
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727367![]() | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.75 |
MMs01727369![]() | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.75 |
MMs01727371![]() | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.75 |
MMs01727372![]() | O1C2C(OC3OC(CC(=O)C13O)C)C(O)C(NC)C(O)C2NC | 0.75 |
MMs01727735![]() | O1C(CO)C(O)C(O)C(NC)C1OC1C(O)(C=O)C(OC1OC1C(NC(N)=N)C(O)C(NC(N)=N)C(O)C1O)C | 0.72 |
MMs01727374![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |
MMs01727375![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |
MMs01727376![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |
MMs01727373![]() | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.71 |