Drugs present in MMsINC which are similar to the molecule MMscode: MMs03128989
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725049 | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.76 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.74 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.74 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.74 |
MMs01724727 | Brc1ccc(cc1)C(OCCN(C)C)c1ccccc1 | 0.72 |
MMs01725715 | O(CCCN(C)C)C1(CCCCCC1)Cc1ccccc1 | 0.72 |
MMs01724737 | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.70 |
MMs01725786 | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.70 |