Drugs present in MMsINC which are similar to the molecule MMscode: MMs03099167
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.77 |
MMs01725513 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.75 |
MMs01725511 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.75 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.74 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.74 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.74 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.74 |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.72 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.72 |
MMs01727220 | O1CCN(C)C(C)C1c1ccccc1 | 0.72 |
MMs01727222 | O1CCN(C)C(C)C1c1ccccc1 | 0.72 |
MMs01725372 | O1CCN(C)C(C)C1c1ccccc1 | 0.72 |
MMs01724917 | O1CCN(C)C(C)C1c1ccccc1 | 0.72 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01727287 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |