Drugs present in MMsINC which are similar to the molecule MMscode: MMs03096395
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724771![]() | O(CC(O)CO)c1ccccc1C | 0.76 |
MMs01725109![]() | O(CC(O)CO)c1ccccc1C | 0.76 |
MMs01727460![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.75 |
MMs01727458![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.75 |
MMs01727459![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.75 |
MMs01727457![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.75 |
MMs01725463![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.71 |
MMs01725461![]() | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.71 |