Drugs present in MMsINC which are similar to the molecule MMscode: MMs03080828
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725481 | s1cc(nc1N)/C(=N/OC)/C(=O)NC1C2SCC=C(N2C1=O)C(O)=O | 0.93 |
MMs01726237 | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(CSc3nnnn3C)=C(N2C1=O)C(O)=O | 0.93 |
MMs01726239 | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(CSc3nnnn3C)=C(N2C1=O)C(O)=O | 0.93 |
MMs01726241 | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(CSc3nnnn3C)=C(N2C1=O)C(O)=O | 0.93 |
MMs01726235 | s1cc(nc1N)/C(=N\OC)/C(=O)NC1C2SCC(CSc3nnnn3C)=C(N2C1=O)C(O)=O | 0.93 |
MMs01726233 | s1cc(nc1N)/C(=N/OCC(O)=O)/C(=O)NC1C2SCC(C=C)=C(N2C1=O)C(O)=O | 0.90 |
MMs01726231 | s1cc(nc1N)/C(=N/OCC(O)=O)/C(=O)NC1C2SCC(C=C)=C(N2C1=O)C(O)=O | 0.90 |
MMs01726255 | s1c(CC(O)=O)c(nc1SCC=1CSC2N(C(=O)C2NC(=O)\C(=N\OC)\c2nc(sc2)N)C=1C(O)=O)C | 0.87 |
MMs01726251 | s1c(CC(O)=O)c(nc1SCC=1CSC2N(C(=O)C2NC(=O)\C(=N\OC)\c2nc(sc2)N)C=1C(O)=O)C | 0.87 |
MMs01726253 | s1c(CC(O)=O)c(nc1SCC=1CSC2N(C(=O)C2NC(=O)\C(=N\OC)\c2nc(sc2)N)C=1C(O)=O)C | 0.87 |
MMs01725479 | s1cc(nc1N)/C(=N\OC(C(O)=O)(C)C)/C(=O)NC1C2SCC(C[n+]3ccccc3)=C(N2C1=O)C(O)=O | 0.72 |