Drugs present in MMsINC which are similar to the molecule MMscode: MMs03064263
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727510 | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.74 |
MMs01727513 | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.74 |
MMs01727512 | O1c2cc3C([N+](CCc3cc2OC)(C)C)Cc2ccc(Oc3c4C([N+](CCc4cc(OC)c3OC)(C)C)Cc3cc1c(OC)cc3)cc2 | 0.74 |
MMs01724821 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.73 |
MMs01725755 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.73 |
MMs01724731 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.72 |
MMs01725838 | O(C)c1cc2C34C(C(N(CC3)C)Cc2cc1)CCCC4 | 0.72 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.70 |