Drugs present in MMsINC which are similar to the molecule MMscode: MMs03051468
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725031 | S1Cc2c(cccc2)\C(\c2c1cccc2)=C/CC[NH+](C)C | 0.73 |
MMs01724995 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.72 |
MMs01727042 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.72 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.72 |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.72 |