Drugs present in MMsINC which are similar to the molecule MMscode: MMs03051440
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724995 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.75 |
MMs01727042 | S(=O)(C(c1ccccc1)c1ccccc1)CC(=O)N | 0.75 |
MMs01725031 | S1Cc2c(cccc2)\C(\c2c1cccc2)=C/CC[NH+](C)C | 0.75 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.72 |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.72 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.71 |