Drugs present in MMsINC which are similar to the molecule MMscode: MMs03049816
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724821 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.73 |
MMs01725755 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.73 |
MMs01725838 | O(C)c1cc2C34C(C(N(CC3)C)Cc2cc1)CCCC4 | 0.71 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.71 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.71 |