Drugs present in MMsINC which are similar to the molecule MMscode: MMs03049719
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725002 | Oc1c-2c(CC3N(CCc4c3c-2ccc4)C)ccc1O | 0.79 |
MMs01724965 | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.77 |
MMs01725077 | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.77 |
MMs01724821 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.75 |
MMs01725755 | O(C)c1c(OC)cc(cc1OC)CC1NCCc2c1cc(O)c(O)c2 | 0.75 |
MMs01726665 | O(C)c1cc2c(cc1OC)CCNC2CC1CC2N(CC1CC)CCc1cc(OC)c(OC)cc12 | 0.70 |
MMs01726667 | O(C)c1cc2c(cc1OC)CCNC2CC1CC2N(CC1CC)CCc1cc(OC)c(OC)cc12 | 0.70 |