Drugs present in MMsINC which are similar to the molecule MMscode: MMs03041575
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724937 | Clc1ccccc1C[NH+]1CCc2sccc2C1 | 0.81 |
MMs01724922 | s1c2c(cc1)C(c1c(CC2)cccc1)=C1CC[NH+](CC1)C | 0.74 |
MMs01724864 | Clc1ccccc1C1=NCC(=O)N(c2sc(cc12)CC)C | 0.71 |
MMs01725221 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.70 |
MMs01726924 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.70 |