Drugs present in MMsINC which are similar to the molecule MMscode: MMs03031247
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724935![]() | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.74 |
MMs01725223![]() | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.73 |
MMs01725345![]() | S(=O)(=O)(N)c1cc2S(=O)(=O)NC(Nc2cc1C(F)(F)F)Cc1ccccc1 | 0.73 |
MMs01726941![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.73 |
MMs01725799![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.72 |
MMs01725233![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.72 |
MMs01725656![]() | S(=O)(=O)(c1ccc(NCS(O)=O)cc1)c1ccc(NCS(O)=O)cc1 | 0.72 |
MMs01725227![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC1CCCC1 | 0.72 |
MMs01725853![]() | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC1CCCC1 | 0.72 |
MMs01725300![]() | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.70 |
MMs01724823![]() | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.70 |