Drugs present in MMsINC which are similar to the molecule MMscode: MMs03026754
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.87 |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.87 |
MMs01725018 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.87 |
MMs01725308 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.87 |
MMs01725331 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.84 |
MMs01725017 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.84 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.83 |
MMs01725769 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.80 |
MMs01725161 | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.80 |
MMs01725235 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.80 |
MMs01725242 | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.80 |
MMs01725564 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.80 |
MMs01725565 | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.80 |
MMs01724929 | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.78 |
MMs01726926 | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.78 |
MMs01724925 | O=C1NCNC(=O)C1(CC)c1ccccc1 | 0.77 |
MMs01725524 | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.76 |
MMs01725525 | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.76 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.76 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.76 |
MMs01725593 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.74 |
MMs01725592 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.74 |
MMs01725434 | [NH2+](CC12CCC(c3c1cccc3)c1c2cccc1)C | 0.71 |
MMs01725660 | [NH+](CC(CC1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.71 |
MMs01725393 | [NH+]1(CCC(CC1)=C1c2c(C=Cc3c1cccc3)cccc2)C | 0.70 |