Drugs present in MMsINC which are similar to the molecule MMscode: MMs03025302
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725939![]() | O=C1Nc2c(cc([N+](=O)[O-])cc2)C(=NC1)c1ccccc1 | 0.83 |
MMs01727141![]() | O=C1N(c2c(cc([N+](=O)[O-])cc2)C(=NC1)c1ccccc1)C | 0.77 |
MMs01725940![]() | Fc1ccccc1C1=NCC(=O)N(c2c1cc([N+](=O)[O-])cc2)C | 0.76 |
MMs01724921![]() | Clc1cc2c(N(CC#C)C(=O)CN=C2c2ccccc2)cc1 | 0.75 |
MMs01724924![]() | Clc1cc2c(N(CC3CC3)C(=O)CN=C2c2ccccc2)cc1 | 0.74 |
MMs01725160![]() | Clc1cc2c(N(CC(F)(F)F)C(=O)CN=C2c2ccccc2)cc1 | 0.74 |
MMs01724746![]() | Clc1cc2c(N(CCO)C(=O)C(O)N=C2c2ccccc2F)cc1 | 0.71 |
MMs01726644![]() | Clc1cc2c(N(CCO)C(=O)C(O)N=C2c2ccccc2F)cc1 | 0.71 |
MMs01724755![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.70 |
MMs01725336![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.70 |