Drugs present in MMsINC which are similar to the molecule MMscode: MMs03023334
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725063 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.90 |
MMs01724744 | O=C(C(N(CC)CC)C)c1ccccc1 | 0.80 |
MMs01724860 | Clc1ccccc1CC([NH3+])(C)C | 0.74 |
MMs01725092 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |
MMs01725094 | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.71 |
MMs01725157 | Clc1ccc(cc1)C1(CCC1)C([NH+](C)C)CC(C)C | 0.71 |