Drugs present in MMsINC which are similar to the molecule MMscode: MMs02997490
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725798 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.75 |
MMs01724755 | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.75 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.74 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.74 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.72 |
MMs01727470 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.72 |
MMs01727472 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1NC(=O)CCC | 0.72 |