Drugs present in MMsINC which are similar to the molecule MMscode: MMs02975387
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725587 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](CC)(CC)C)=O | 0.73 |
MMs01725361 | O1Cc2c(cccc2)/C(/c2cc(ccc12)CC(O)=O)=C\CCN(C)C | 0.73 |
MMs01725546 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.73 |
MMs01727086 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.72 |
MMs01725534 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.72 |
MMs01727082 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.72 |
MMs01727084 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c2c(ccc1OCC)cccc2 | 0.72 |
MMs01725991 | Ic1cc(cc(I)c1OCCN(CC)CC)C(=O)c1c2c(oc1CCCC)cccc2 | 0.72 |
MMs01725262 | O1c2c(cccc2C(OCCN2CCCCC2)=O)C(=O)C(C)=C1c1ccccc1 | 0.71 |
MMs01725084 | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.71 |