Drugs present in MMsINC which are similar to the molecule MMscode: MMs02970184
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725934 | S(=O)(=O)(Nc1cc(OC)c(Nc2c3c(nc4c2cccc4)cccc3)cc1)C | 0.73 |
MMs01724990 | S(=O)(=O)(NC(=O)NC(C)C)c1cnccc1Nc1cc(ccc1)C | 0.72 |
MMs01725261 | O(CC)c1cc(ccc1OCC)Cc1nccc2c1cc(OCC)c(OCC)c2 | 0.71 |
MMs01725213 | Fc1ccc(cc1)Cn1c2c(nc1NC1CCN(CC1)CCc1ccc(OC)cc1)cccc2 | 0.71 |
MMs01725311 | S(=O)(=O)(NC(=O)c1cc(OC)c(cc1)Cc1c2cc(NC(OC3CCCC3)=O)ccc2n(c1)C)c1ccccc1C | 0.70 |
MMs01724747 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.70 |
MMs01725112 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.70 |