Drugs present in MMsINC which are similar to the molecule MMscode: MMs02924827
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724990![]() | S(=O)(=O)(NC(=O)NC(C)C)c1cnccc1Nc1cc(ccc1)C | 0.77 |
MMs01725826![]() | S(=O)(=O)(N)c1ccc(-n2nc(cc2-c2ccc(cc2)C)C(F)(F)F)cc1 | 0.75 |
MMs01724945![]() | [NH+]1(CCCC1)C\C=C(/c1ccc(cc1)C)\c1ncccc1 | 0.73 |
MMs01724928![]() | O=C1Nc2c(n(nc2C)CC)C(=NC1)c1ccccc1 | 0.72 |
MMs01724967![]() | S(=O)(=O)(NC)CCc1cc2c([nH]cc2C2CCN(CC2)C)cc1 | 0.71 |
MMs01725150![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.71 |
MMs01724798![]() | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.71 |