Drugs present in MMsINC which are similar to the molecule MMscode: MMs02909678
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726609![]() | Ic1c(C(O)=O)c(I)c(NC(=O)C)cc1NC(=O)C | 0.74 |
MMs01725923![]() | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.71 |
MMs01724849![]() | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.71 |
MMs01724905![]() | S1c2c(N(c3c1cccc3)C)cc(cc2)CC(O)=O | 0.70 |
MMs01726849![]() | Ic1c(CNC(=O)C)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.70 |
MMs01725588![]() | Clc1cc(N)ccc1C(OCCN(CC)CC)=O | 0.70 |