Drugs present in MMsINC which are similar to the molecule MMscode: MMs02866206
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725511![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.73 |
MMs01725513![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.73 |
MMs01724937![]() | Clc1ccccc1C[NH+]1CCc2sccc2C1 | 0.71 |
MMs01725704![]() | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.70 |
MMs01727347![]() | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.70 |
MMs01727349![]() | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.70 |