Drugs present in MMsINC which are similar to the molecule MMscode: MMs02850771
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.73 |
MMs01725715 | O(CCCN(C)C)C1(CCCCCC1)Cc1ccccc1 | 0.72 |
MMs01725387 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725386 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01724764 | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725733 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725734 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725735 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |