Drugs present in MMsINC which are similar to the molecule MMscode: MMs02842230
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727466 | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.82 |
MMs01727467 | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.82 |
MMs01727464 | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.82 |
MMs01727465 | [S+]12C(C3N(Cc4ccccc4)C(=O)N(C3C1)Cc1ccccc1)CCC2 | 0.82 |
MMs01725794 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.82 |
MMs01725433 | [N+]1(CCC(=C(c2ccccc2)c2ccccc2)C1C)(CC)CC | 0.82 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.79 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.74 |
MMs01725440 | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.73 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.72 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.71 |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.71 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.71 |