Drugs present in MMsINC which are similar to the molecule MMscode: MMs02839966
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.87 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.75 |
MMs01726673 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01726671 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01725949 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01726669 | O(C(=O)C(NC(C(=O)N1CCCC1C(O)=O)C)CCc1ccccc1)CC | 0.72 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.71 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.71 |
MMs01725769 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.70 |
MMs01725242 | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.70 |
MMs01725235 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.70 |
MMs01725161 | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.70 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.70 |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.70 |