Drugs present in MMsINC which are similar to the molecule MMscode: MMs02839659
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725247![]() | O(C(=O)C1(CCN(CC1)CCc1ccc(N)cc1)c1ccccc1)CC | 0.79 |
MMs01725733![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.74 |
MMs01725734![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.74 |
MMs01725735![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.74 |
MMs01725596![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.74 |
MMs01725438![]() | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.73 |
MMs01726044![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.73 |
MMs01725455![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.73 |
MMs01725866![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.73 |
MMs01725771![]() | O=C1N(c2c(CCC1NC(CCc1ccccc1)C(OCC)=O)cccc2)CC(O)=O | 0.73 |
MMs01725425![]() | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.72 |
MMs01724782![]() | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.72 |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.72 |
MMs01727468![]() | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.71 |