Drugs present in MMsINC which are similar to the molecule MMscode: MMs02839279
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725588 | Clc1cc(N)ccc1C(OCCN(CC)CC)=O | 0.84 |
MMs01725247 | O(C(=O)C1(CCN(CC1)CCc1ccc(N)cc1)c1ccccc1)CC | 0.79 |
MMs01726675 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.75 |
MMs01726677 | O(C)c1ccc(cc1)C(=O)Nc1ccc(cc1)CCN1CCCCC1C | 0.75 |
MMs01725258 | Clc1cc(C(=O)NC2CCN(CC2)Cc2ccccc2)c(OC)cc1N | 0.74 |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.72 |
MMs01727297 | O(CC)c1cc(ccc1C(O)=O)CC(=O)NC(CC(C)C)c1ccccc1N1CCCCC1 | 0.71 |
MMs01725895 | O(CC)c1cc(ccc1C(O)=O)CC(=O)NC(CC(C)C)c1ccccc1N1CCCCC1 | 0.71 |
MMs01726462 | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.70 |
MMs01725857 | Clc1cc(C(=O)NC2CCN(CC2OC)CCCOc2ccc(F)cc2)c(OC)cc1N | 0.70 |