Drugs present in MMsINC which are similar to the molecule MMscode: MMs02828446
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725418![]() | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.76 |
MMs01725203![]() | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.76 |
MMs01724747![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.75 |
MMs01725112![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.75 |
MMs01725860![]() | OC(=O)\C=C\c1nc(ccc1)/C(=C\CN1CCCC1)/c1ccc(cc1)C | 0.73 |
MMs01724766![]() | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.72 |
MMs01725710![]() | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.70 |
MMs01726778![]() | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.70 |
MMs01726780![]() | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.70 |