Drugs present in MMsINC which are similar to the molecule MMscode: MMs02826259
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725298![]() | [NH3+]C1CC1c1ccccc1 | 0.80 |
MMs01725649![]() | [NH3+]C1CC1c1ccccc1 | 0.80 |
MMs01725446![]() | [NH3+]C1CC1c1ccccc1 | 0.80 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.80 |
MMs01725647![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.78 |
MMs01725848![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.78 |
MMs01725331![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.78 |
MMs01725017![]() | O=C1N(C)C(=O)CC1c1ccccc1 | 0.78 |
MMs01727529![]() | [NH3+]C(Cc1ccccc1)C | 0.77 |
MMs01727527![]() | [NH3+]C(Cc1ccccc1)C | 0.77 |
MMs01725564![]() | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.77 |
MMs01725565![]() | O=C1NC(=O)CCC1(CC)c1ccccc1 | 0.77 |
MMs01725308![]() | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.76 |
MMs01725018![]() | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.76 |
MMs01724925![]() | O=C1NCNC(=O)C1(CC)c1ccccc1 | 0.75 |
MMs01725524![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.73 |
MMs01725525![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.73 |
MMs01724929![]() | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.72 |
MMs01726926![]() | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.72 |
MMs01725549![]() | [NH2+](CCCC1c2c(C=Cc3c1cccc3)cccc2)C | 0.71 |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01725309![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.71 |
MMs01725660![]() | [NH+](CC(CC1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.71 |
MMs01724744![]() | O=C(C(N(CC)CC)C)c1ccccc1 | 0.70 |