Drugs present in MMsINC which are similar to the molecule MMscode: MMs02825889
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725059![]() | S1c2c(N(c3c1cccc3)CCCN(C)C)cc(cc2)C(=O)C | 0.92 |
MMs01725167![]() | S1c2c(N(c3c1cccc3)CCCN1CCC(CC1)CCO)cc(cc2)C(=O)C | 0.91 |
MMs01724810![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.89 |
MMs01726775![]() | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)CCOC(=O)CCCCCC)cc(cc2)C(F)(F)F | 0.85 |
MMs01725180![]() | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCN(CC1)CCOC(=O)C | 0.75 |
MMs01725165![]() | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC(CC1)C(=O)N | 0.72 |
MMs01724792![]() | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.72 |
MMs01725796![]() | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.72 |
MMs01726828![]() | S1c2c(C(=O)c3c1cccc3)c(NCCN(CC)CC)ccc2CO | 0.70 |
MMs01725743![]() | S1c2c(N(c3c1cccc3)CC1C3CC[NH+](C1)CC3)cccc2 | 0.70 |
MMs01725177![]() | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)C)cc(SCC)cc2 | 0.70 |