Drugs present in MMsINC which are similar to the molecule MMscode: MMs02823845
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725545 | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.80 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.78 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.78 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01726849 | Ic1c(CNC(=O)C)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.73 |
MMs01726609 | Ic1c(C(O)=O)c(I)c(NC(=O)C)cc1NC(=O)C | 0.72 |
MMs01727015 | Ic1c(C(O)=O)c(I)c(NC(=O)C)c(I)c1N(C(=O)C)C | 0.72 |
MMs01726878 | Ic1c(C(=O)NC)c(I)c(NC(=O)C)c(I)c1C(O)=O | 0.71 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.70 |