Drugs present in MMsINC which are similar to the molecule MMscode: MMs02819559
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724865![]() | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.77 |
MMs01724924![]() | Clc1cc2c(N(CC3CC3)C(=O)CN=C2c2ccccc2)cc1 | 0.73 |
MMs01724921![]() | Clc1cc2c(N(CC#C)C(=O)CN=C2c2ccccc2)cc1 | 0.72 |
MMs01725061![]() | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.72 |
MMs01725160![]() | Clc1cc2c(N(CC(F)(F)F)C(=O)CN=C2c2ccccc2)cc1 | 0.72 |
MMs01726730![]() | Clc1cc(N2CCN(CC2)CCCN2N=C(N(CC)C2=O)CC)ccc1 | 0.70 |
MMs01726486![]() | Clc1ccc(N2C3=C\C(=N/C(C)C)\C(Nc4ccc(Cl)cc4)=CC3=Nc3c2cccc3)cc1 | 0.70 |