Drugs present in MMsINC which are similar to the molecule MMscode: MMs02814493
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725096 | Clc1ccc(cc1)C(=O)c1n(C)c(cc1C)CC(O)=O | 0.82 |
MMs01725710 | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.75 |
MMs01726778 | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.75 |
MMs01726780 | Fc1ccc(cc1)-c1c2c(n(C(C)C)c1\C=C\C(O)CC(O)CC(O)=O)cccc2 | 0.75 |
MMs01726743 | Clc1ccc(cc1)-c1nc(sc1C(O)=O)-c1ccccc1 | 0.71 |