Drugs present in MMsINC which are similar to the molecule MMscode: MMs02806168
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725559 | O(CCCCCOc1ccc(cc1)C(N)=N)c1ccc(cc1)C(N)=N | 0.79 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.78 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.78 |
MMs01725668 | Oc1ccc(cc1)CC(N)C | 0.72 |
MMs01724993 | O(C)c1ccc(cc1)C(CN(C)C)C1(O)CCCCC1 | 0.71 |
MMs01725306 | O(C)c1ccc(cc1)C(CN(C)C)C1(O)CCCCC1 | 0.71 |