Drugs present in MMsINC which are similar to the molecule MMscode: MMs02759249
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727497 | O1C(C)C(O)C(N)CC1OC1CC(O)(Cc2c1c(O)c1c(C(=O)c3c(C1=O)c(OC)ccc3)c2O)/C(=N\NC(=O)c1ccccc1)/C | 0.75 |
MMs01727499 | O1C(C)C(O)C(N)CC1OC1CC(O)(Cc2c1c(O)c1c(C(=O)c3c(C1=O)c(OC)ccc3)c2O)/C(=N\NC(=O)c1ccccc1)/C | 0.75 |
MMs01727501 | O1C(C)C(O)C(N)CC1OC1CC(O)(Cc2c1c(O)c1c(C(=O)c3c(C1=O)c(OC)ccc3)c2O)/C(=N\NC(=O)c1ccccc1)/C | 0.75 |
MMs01727503 | O1C(C)C(O)C(N)CC1OC1CC(O)(Cc2c1c(O)c1c(C(=O)c3c(C1=O)c(OC)ccc3)c2O)/C(=N\NC(=O)c1ccccc1)/C | 0.75 |
MMs01725768 | O1c2c(OC1)cc1c(c2)C(C(C(=O)NNCC)C(CO)C1O)c1cc(OC)c(OC)c(OC)c1 | 0.72 |
MMs01724751 | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.71 |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.71 |