Drugs present in MMsINC which are similar to the molecule MMscode: MMs02738589
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725592 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.81 |
MMs01725593 | O=C1NC(=O)CCC1N1C(=O)c2c(cccc2)C1=O | 0.81 |
MMs01725331 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.73 |
MMs01725017 | O=C1N(C)C(=O)CC1c1ccccc1 | 0.73 |
MMs01725161 | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.73 |
MMs01725235 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725242 | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.73 |
MMs01725769 | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.73 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.73 |
MMs01725308 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.72 |
MMs01725018 | O=C1N(C)C(=O)CC1(C)c1ccccc1 | 0.72 |
MMs01724744 | O=C(C(N(CC)CC)C)c1ccccc1 | 0.72 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.71 |