Drugs present in MMsINC which are similar to the molecule MMscode: MMs02737674
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.76 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.72 |
MMs01724926 | O=C1N=C(c2c(N1C(C)C)cc(cc2)C)c1ccccc1 | 0.71 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.71 |
MMs01725549 | [NH2+](CCCC1c2c(C=Cc3c1cccc3)cccc2)C | 0.70 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.70 |
MMs01725632 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.70 |
MMs01725434 | [NH2+](CC12CCC(c3c1cccc3)c1c2cccc1)C | 0.70 |
MMs01724788 | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.70 |