Drugs present in MMsINC which are similar to the molecule MMscode: MMs02725692
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726782 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.71 |
MMs01726784 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.71 |
MMs01725055 | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.71 |
MMs01725799 | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC(C)C | 0.71 |
MMs01724792 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.71 |
MMs01725796 | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.71 |