Drugs present in MMsINC which are similar to the molecule MMscode: MMs02702823
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724846 | Clc1cc(ccc1C1CCCCC1)C(=O)CCC(O)=O | 0.76 |
MMs01726091 | FC12C(C3CC(C)C(OC(=O)c4ccccc4)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.73 |
MMs01726092 | FC12C(C3CC(C)C(OC(=O)c4ccccc4)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.73 |
MMs01726088 | FC12C(C3CC(C)C(OC(=O)c4ccccc4)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.73 |
MMs01726090 | FC12C(C3CC(C)C(OC(=O)c4ccccc4)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)C=CC12C | 0.73 |
MMs01726475 | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.72 |
MMs01724741 | Clc1cc2c(cc1C1CCCCC1)CCC2C(O)=O | 0.72 |
MMs01725788 | OC(=O)CCC(=O)c1cc-2c(-c3c4c-2cccc4ccc3)cc1 | 0.70 |