Drugs present in MMsINC which are similar to the molecule MMscode: MMs02697205
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726741 | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.84 |
MMs01724798 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.74 |
MMs01725150 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.74 |
MMs01725429 | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.74 |
MMs01725443 | [NH+](CCC=1Cc2c(cccc2)C=1C(C)c1ncccc1)(C)C | 0.74 |
MMs01725411 | [NH+]1(CCC(CC1)=C1c2c(CCc3c1nccc3)cccc2)C | 0.72 |
MMs01725814 | s1cccc1CN(CCN(C)C)c1ncccc1 | 0.70 |